C19H15NO4 — CID 122378677
2-amino-4-(4-methoxyphenyl)-4H-pyrano[3,2-c]chromen-5-one (PubChem CID 122378677) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-amino-4-(4-methoxyphenyl)-4H-pyrano[3,2-c]chromen-5-one.
| Compound Name | 2-amino-4-(4-methoxyphenyl)-4H-pyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 122378677 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-amino-4-(4-methoxyphenyl)-4H-pyrano[3,2-c]chromen-5-one |
| SMILES | COc1ccc(C2C=C(N)Oc3c2c(=O)oc2ccccc32)cc1 |
| InChI | InChI=1S/C19H15NO4/c1-22-12-8-6-11(7-9-12)14-10-16(20)24-18-13-4-2-3-5-15(13)23-19(21)17(14)18/h2-10,14H,20H2,1H3 |
| InChIKey | MCZPWMFVRLVCDA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|