C18H11ClO5 — CID 91638083
4-(3-chloro-4-hydroxyphenyl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione (PubChem CID 91638083) has the molecular formula C18H11ClO5 and a molecular weight of 342.73 g/mol. Its IUPAC name is 4-(3-chloro-4-hydroxyphenyl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione.
| Compound Name | 4-(3-chloro-4-hydroxyphenyl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
|---|---|
| PubChem CID | 91638083 |
| Molecular Formula | C18H11ClO5 |
| Molecular Weight | 342.73 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 4-(3-chloro-4-hydroxyphenyl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
| SMILES | O=C1CC(c2ccc(O)c(Cl)c2)c2c(c3ccccc3oc2=O)O1 |
| InChI | InChI=1S/C18H11ClO5/c19-12-7-9(5-6-13(12)20)11-8-15(21)24-17-10-3-1-2-4-14(10)23-18(22)16(11)17/h1-7,11,20H,8H2 |
| InChIKey | HVBZCVDEAYTKIE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.73 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|