C27H21NO8 — CID 25286295
(4S)-4-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]-3,4-dihydropyrano[3,2-c]chromene-2,5-dione (PubChem CID 25286295) has the molecular formula C27H21NO8 and a molecular weight of 487.46 g/mol. Its IUPAC name is (4S)-4-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]-3,4-dihydropyrano[3,2-c]chromene-2,5-dione.
| Compound Name | (4S)-4-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
|---|---|
| PubChem CID | 25286295 |
| Molecular Formula | C27H21NO8 |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | (4S)-4-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
| SMILES | COc1ccc([C@@H]2CC(=O)Oc3c2c(=O)oc2ccccc32)cc1COc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C27H21NO8/c1-15-11-18(8-9-21(15)28(31)32)34-14-17-12-16(7-10-22(17)33-2)20-13-24(29)36-26-19-5-3-4-6-23(19)35-27(30)25(20)26/h3-12,20H,13-14H2,1-2H3/t20-/m0/s1 |
| InChIKey | MRGZFASGRKMTAN-FQEVSTJZSA-N |
| XLogP | 5.04 |
| TPSA | 118.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|