C32H21NO7 — CID 2887530
13-[4-methoxy-3-(pyridin-2-yloxymethyl)phenyl]-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4,6,8,17,19,21-octaene-11,15-dione (PubChem CID 2887530) has the molecular formula C32H21NO7 and a molecular weight of 531.52 g/mol. Its IUPAC name is 13-[4-methoxy-3-(pyridin-2-yloxymethyl)phenyl]-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4,6,8,17,19,21-octaene-11,15-dione.
| Compound Name | 13-[4-methoxy-3-(pyridin-2-yloxymethyl)phenyl]-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4,6,8,17,19,21-octaene-11,15-dione |
|---|---|
| PubChem CID | 2887530 |
| Molecular Formula | C32H21NO7 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 13-[4-methoxy-3-(pyridin-2-yloxymethyl)phenyl]-2,10,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4,6,8,17,19,21-octaene-11,15-dione |
| SMILES | COc1ccc(C2c3c(c4ccccc4oc3=O)Oc3c2c(=O)oc2ccccc32)cc1COc1ccccn1 |
| InChI | InChI=1S/C32H21NO7/c1-36-22-14-13-18(16-19(22)17-37-25-12-6-7-15-33-25)26-27-29(20-8-2-4-10-23(20)38-31(27)34)40-30-21-9-3-5-11-24(21)39-32(35)28(26)30/h2-16,26H,17H2,1H3 |
| InChIKey | ATLCNWVSUIUOPI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 101.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|