C25H18BrN5O6 — CID 94855549
(4S)-2-amino-4-[3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 94855549) has the molecular formula C25H18BrN5O6 and a molecular weight of 564.35 g/mol. Its IUPAC name is (4S)-2-amino-4-[3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-[3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 94855549 |
| Molecular Formula | C25H18BrN5O6 |
| Molecular Weight | 564.35 g/mol |
| Exact Mass | 563.04 |
| IUPAC Name | (4S)-2-amino-4-[3-[(4-bromo-5-methyl-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | COc1ccc([C@H]2C(C#N)=C(N)Oc3c2c(=O)oc2ccccc32)cc1Cn1nc([N+](=O)[O-])c(Br)c1C |
| InChI | InChI=1S/C25H18BrN5O6/c1-12-21(26)24(31(33)34)29-30(12)11-14-9-13(7-8-17(14)35-2)19-16(10-27)23(28)37-22-15-5-3-4-6-18(15)36-25(32)20(19)22/h3-9,19H,11,28H2,1-2H3/t19-/m0/s1 |
| InChIKey | BPCGFEPFMLXFNS-IBGZPJMESA-N |
| XLogP | 4.24 |
| TPSA | 159.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|