C31H32IN3O8 — CID 126083316
9-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126083316) has the molecular formula C31H32IN3O8 and a molecular weight of 701.51 g/mol. Its IUPAC name is 9-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126083316 |
| Molecular Formula | C31H32IN3O8 |
| Molecular Weight | 701.51 g/mol |
| Exact Mass | 701.12 |
| IUPAC Name | 9-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-3,3,6,6,10-pentamethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)N(C)C3=C2C(=O)CC(C)(C)C3)cc(I)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H32IN3O8/c1-30(2)12-20-27(22(36)14-30)26(28-21(33(20)5)13-31(3,4)15-23(28)37)16-9-18(32)29(25(10-16)42-6)43-24-8-7-17(34(38)39)11-19(24)35(40)41/h7-11,26H,12-15H2,1-6H3 |
| InChIKey | CNYPBCOAAHPAKH-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.51 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|