C30H32ClNO5S — CID 126080086
[2-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate (PubChem CID 126080086) has the molecular formula C30H32ClNO5S and a molecular weight of 554.11 g/mol. Its IUPAC name is [2-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126080086 |
| Molecular Formula | C30H32ClNO5S |
| Molecular Weight | 554.11 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | [2-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate |
| SMILES | CN1C2=C(C(=O)CC(C)(C)C2)C(c2ccccc2OS(=O)(=O)c2ccc(Cl)cc2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C30H32ClNO5S/c1-29(2)14-21-27(23(33)16-29)26(28-22(32(21)5)15-30(3,4)17-24(28)34)20-8-6-7-9-25(20)37-38(35,36)19-12-10-18(31)11-13-19/h6-13,26H,14-17H2,1-5H3 |
| InChIKey | RFRWMUIVZNHPRH-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.11 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|