C18H20O5S — CID 126128719
[4-(hydroxymethyl)-2-methoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate (PubChem CID 126128719) has the molecular formula C18H20O5S and a molecular weight of 348.42 g/mol. Its IUPAC name is [4-(hydroxymethyl)-2-methoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(hydroxymethyl)-2-methoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126128719 |
| Molecular Formula | C18H20O5S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | [4-(hydroxymethyl)-2-methoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
| SMILES | C=CCc1cc(CO)cc(OC)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20O5S/c1-4-5-15-10-14(12-19)11-17(22-3)18(15)23-24(20,21)16-8-6-13(2)7-9-16/h4,6-11,19H,1,5,12H2,2-3H3 |
| InChIKey | YDAWWLWZMFFGTO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|