C17H16N2O7 — CID 126117483
[4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]methanol (PubChem CID 126117483) has the molecular formula C17H16N2O7 and a molecular weight of 360.32 g/mol. Its IUPAC name is [4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]methanol.
| Compound Name | [4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]methanol |
|---|---|
| PubChem CID | 126117483 |
| Molecular Formula | C17H16N2O7 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]methanol |
| SMILES | C=CCc1cc(CO)cc(OC)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N2O7/c1-3-4-12-7-11(10-20)8-16(25-2)17(12)26-15-6-5-13(18(21)22)9-14(15)19(23)24/h3,5-9,20H,1,4,10H2,2H3 |
| InChIKey | BHZVPMQQGZSKRO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|