C13H8Br2N2O6 — CID 126116017
[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]methanol (PubChem CID 126116017) has the molecular formula C13H8Br2N2O6 and a molecular weight of 448.02 g/mol. Its IUPAC name is [3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]methanol.
| Compound Name | [3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]methanol |
|---|---|
| PubChem CID | 126116017 |
| Molecular Formula | C13H8Br2N2O6 |
| Molecular Weight | 448.02 g/mol |
| Exact Mass | 445.87 |
| IUPAC Name | [3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(Oc2c(Br)cc(CO)cc2Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H8Br2N2O6/c14-9-3-7(6-18)4-10(15)13(9)23-12-2-1-8(16(19)20)5-11(12)17(21)22/h1-5,18H,6H2 |
| InChIKey | JJJWDAWNDCCRFH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.02 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|