C23H23Cl2NO5 — CID 126047851
2-[9-(3,5-dichloro-2-ethoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126047851) has the molecular formula C23H23Cl2NO5 and a molecular weight of 464.35 g/mol. Its IUPAC name is 2-[9-(3,5-dichloro-2-ethoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-(3,5-dichloro-2-ethoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126047851 |
| Molecular Formula | C23H23Cl2NO5 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-[9-(3,5-dichloro-2-ethoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
| SMILES | CCOc1c(Cl)cc(Cl)cc1C1C2=C(CCCC2=O)N(CC(=O)O)C2=C1C(=O)CCC2 |
| InChI | InChI=1S/C23H23Cl2NO5/c1-2-31-23-13(9-12(24)10-14(23)25)20-21-15(5-3-7-17(21)27)26(11-19(29)30)16-6-4-8-18(28)22(16)20/h9-10,20H,2-8,11H2,1H3,(H,29,30) |
| InChIKey | JKOOPEKYCKPFHG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |