C21H21Cl2NO3 — CID 126060362
9-(3,5-dichloro-2-ethoxyphenyl)-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione (PubChem CID 126060362) has the molecular formula C21H21Cl2NO3 and a molecular weight of 406.31 g/mol. Its IUPAC name is 9-(3,5-dichloro-2-ethoxyphenyl)-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione.
| Compound Name | 9-(3,5-dichloro-2-ethoxyphenyl)-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 126060362 |
| Molecular Formula | C21H21Cl2NO3 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 9-(3,5-dichloro-2-ethoxyphenyl)-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
| SMILES | CCOc1c(Cl)cc(Cl)cc1C1C2=C(CCCC2=O)NC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C21H21Cl2NO3/c1-2-27-21-12(9-11(22)10-13(21)23)18-19-14(5-3-7-16(19)25)24-15-6-4-8-17(26)20(15)18/h9-10,18,24H,2-8H2,1H3 |
| InChIKey | FAXRWZYBUOARLB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |