C22H23Cl2NO3 — CID 126052762
9-(3,5-dichloro-2-hydroxyphenyl)-10-propyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 126052762) has the molecular formula C22H23Cl2NO3 and a molecular weight of 420.34 g/mol. Its IUPAC name is 9-(3,5-dichloro-2-hydroxyphenyl)-10-propyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(3,5-dichloro-2-hydroxyphenyl)-10-propyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126052762 |
| Molecular Formula | C22H23Cl2NO3 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 9-(3,5-dichloro-2-hydroxyphenyl)-10-propyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | CCCN1C2=C(C(=O)CCC2)C(c2cc(Cl)cc(Cl)c2O)C2=C1CCCC2=O |
| InChI | InChI=1S/C22H23Cl2NO3/c1-2-9-25-15-5-3-7-17(26)20(15)19(21-16(25)6-4-8-18(21)27)13-10-12(23)11-14(24)22(13)28/h10-11,19,28H,2-9H2,1H3 |
| InChIKey | JZGHRWIJMFYIHE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |