C23H25Cl2NO4 — CID 126055720
9-(3,5-dichloro-2-hydroxyphenyl)-10-(3-methoxypropyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 126055720) has the molecular formula C23H25Cl2NO4 and a molecular weight of 450.36 g/mol. Its IUPAC name is 9-(3,5-dichloro-2-hydroxyphenyl)-10-(3-methoxypropyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(3,5-dichloro-2-hydroxyphenyl)-10-(3-methoxypropyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126055720 |
| Molecular Formula | C23H25Cl2NO4 |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 9-(3,5-dichloro-2-hydroxyphenyl)-10-(3-methoxypropyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | COCCCN1C2=C(C(=O)CCC2)C(c2cc(Cl)cc(Cl)c2O)C2=C1CCCC2=O |
| InChI | InChI=1S/C23H25Cl2NO4/c1-30-10-4-9-26-16-5-2-7-18(27)21(16)20(22-17(26)6-3-8-19(22)28)14-11-13(24)12-15(25)23(14)29/h11-12,20,29H,2-10H2,1H3 |
| InChIKey | QFDQYNRDIWLSKR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|