C34H37Cl2NO6 — CID 126074472
4-[[2,4-dichloro-6-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]methyl]benzoic acid (PubChem CID 126074472) has the molecular formula C34H37Cl2NO6 and a molecular weight of 626.58 g/mol. Its IUPAC name is 4-[[2,4-dichloro-6-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,4-dichloro-6-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126074472 |
| Molecular Formula | C34H37Cl2NO6 |
| Molecular Weight | 626.58 g/mol |
| Exact Mass | 625.20 |
| IUPAC Name | 4-[[2,4-dichloro-6-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenoxy]methyl]benzoic acid |
| SMILES | COCCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Cl)cc(Cl)c2OCc2ccc(C(=O)O)cc2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C34H37Cl2NO6/c1-33(2)14-24-29(26(38)16-33)28(30-25(37(24)10-11-42-5)15-34(3,4)17-27(30)39)22-12-21(35)13-23(36)31(22)43-18-19-6-8-20(9-7-19)32(40)41/h6-9,12-13,28H,10-11,14-18H2,1-5H3,(H,40,41) |
| InChIKey | HHVZAHYFTNTCNA-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.58 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |