C33H37NO5 — CID 126074224
4-[[3-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid (PubChem CID 126074224) has the molecular formula C33H37NO5 and a molecular weight of 527.66 g/mol. Its IUPAC name is 4-[[3-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[3-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126074224 |
| Molecular Formula | C33H37NO5 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | 4-[[3-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]methyl]benzoic acid |
| SMILES | CCN1C2=C(C(=O)CC(C)(C)C2)C(c2cccc(OCc3ccc(C(=O)O)cc3)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C33H37NO5/c1-6-34-24-15-32(2,3)17-26(35)29(24)28(30-25(34)16-33(4,5)18-27(30)36)22-8-7-9-23(14-22)39-19-20-10-12-21(13-11-20)31(37)38/h7-14,28H,6,15-19H2,1-5H3,(H,37,38) |
| InChIKey | QDXICGUWNCFUTB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |