C37H37N3O6 — CID 70685402
4-nitro-N-[3,3,6,6-tetramethyl-1,8-dioxo-9-(3-phenylmethoxyphenyl)-4,5,7,9-tetrahydro-2H-acridin-10-yl]benzamide (PubChem CID 70685402) has the molecular formula C37H37N3O6 and a molecular weight of 619.72 g/mol. Its IUPAC name is 4-nitro-N-[3,3,6,6-tetramethyl-1,8-dioxo-9-(3-phenylmethoxyphenyl)-4,5,7,9-tetrahydro-2H-acridin-10-yl]benzamide.
| Compound Name | 4-nitro-N-[3,3,6,6-tetramethyl-1,8-dioxo-9-(3-phenylmethoxyphenyl)-4,5,7,9-tetrahydro-2H-acridin-10-yl]benzamide |
|---|---|
| PubChem CID | 70685402 |
| Molecular Formula | C37H37N3O6 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | 4-nitro-N-[3,3,6,6-tetramethyl-1,8-dioxo-9-(3-phenylmethoxyphenyl)-4,5,7,9-tetrahydro-2H-acridin-10-yl]benzamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(NC(=O)c1ccc([N+](=O)[O-])cc1)C1=C(C(=O)CC(C)(C)C1)C2c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C37H37N3O6/c1-36(2)18-28-33(30(41)20-36)32(25-11-8-12-27(17-25)46-22-23-9-6-5-7-10-23)34-29(19-37(3,4)21-31(34)42)39(28)38-35(43)24-13-15-26(16-14-24)40(44)45/h5-17,32H,18-22H2,1-4H3,(H,38,43) |
| InChIKey | HJNPMZUKEPAIPL-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|