C28H30N4O5 — CID 126151334
(4R)-2-amino-1-(2-methoxyethyl)-7,7-dimethyl-4-[4-[(3-nitrophenyl)methoxy]phenyl]-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile (PubChem CID 126151334) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is (4R)-2-amino-1-(2-methoxyethyl)-7,7-dimethyl-4-[4-[(3-nitrophenyl)methoxy]phenyl]-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile.
| Compound Name | (4R)-2-amino-1-(2-methoxyethyl)-7,7-dimethyl-4-[4-[(3-nitrophenyl)methoxy]phenyl]-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 126151334 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | (4R)-2-amino-1-(2-methoxyethyl)-7,7-dimethyl-4-[4-[(3-nitrophenyl)methoxy]phenyl]-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
| SMILES | COCCN1C(N)=C(C#N)[C@@H](c2ccc(OCc3cccc([N+](=O)[O-])c3)cc2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C28H30N4O5/c1-28(2)14-23-26(24(33)15-28)25(22(16-29)27(30)31(23)11-12-36-3)19-7-9-21(10-8-19)37-17-18-5-4-6-20(13-18)32(34)35/h4-10,13,25H,11-12,14-15,17,30H2,1-3H3/t25-/m1/s1 |
| InChIKey | PCXUZAOZNLQISS-RUZDIDTESA-N |
| XLogP | 4.56 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|