C28H29BrN4O5 — CID 126147230
(4R)-2-amino-4-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]-1-(2-methoxyethyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile (PubChem CID 126147230) has the molecular formula C28H29BrN4O5 and a molecular weight of 581.47 g/mol. Its IUPAC name is (4R)-2-amino-4-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]-1-(2-methoxyethyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile.
| Compound Name | (4R)-2-amino-4-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]-1-(2-methoxyethyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 126147230 |
| Molecular Formula | C28H29BrN4O5 |
| Molecular Weight | 581.47 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | (4R)-2-amino-4-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]-1-(2-methoxyethyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
| SMILES | COCCN1C(N)=C(C#N)[C@@H](c2ccc(OCc3ccc([N+](=O)[O-])cc3)c(Br)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C28H29BrN4O5/c1-28(2)13-22-26(23(34)14-28)25(20(15-30)27(31)32(22)10-11-37-3)18-6-9-24(21(29)12-18)38-16-17-4-7-19(8-5-17)33(35)36/h4-9,12,25H,10-11,13-14,16,31H2,1-3H3/t25-/m1/s1 |
| InChIKey | FUYXJGAATOAMPQ-RUZDIDTESA-N |
| XLogP | 5.32 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|