C35H42N2O4 — CID 126264443
N-(2-methylphenyl)-2-[3-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide (PubChem CID 126264443) has the molecular formula C35H42N2O4 and a molecular weight of 554.73 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-[3-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide.
| Compound Name | N-(2-methylphenyl)-2-[3-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126264443 |
| Molecular Formula | C35H42N2O4 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | N-(2-methylphenyl)-2-[3-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenoxy]acetamide |
| SMILES | CCCN1C2=C(C(=O)CC(C)(C)C2)C(c2cccc(OCC(=O)Nc3ccccc3C)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C35H42N2O4/c1-7-15-37-26-17-34(3,4)19-28(38)32(26)31(33-27(37)18-35(5,6)20-29(33)39)23-12-10-13-24(16-23)41-21-30(40)36-25-14-9-8-11-22(25)2/h8-14,16,31H,7,15,17-21H2,1-6H3,(H,36,40) |
| InChIKey | SMBUWHAHHKFXSA-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |