C32H33Cl4NO3 — CID 126064044
9-[3,5-dichloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126064044) has the molecular formula C32H33Cl4NO3 and a molecular weight of 621.43 g/mol. Its IUPAC name is 9-[3,5-dichloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3,5-dichloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126064044 |
| Molecular Formula | C32H33Cl4NO3 |
| Molecular Weight | 621.43 g/mol |
| Exact Mass | 619.12 |
| IUPAC Name | 9-[3,5-dichloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]-10-ethyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(Cl)cc(Cl)c2OCc2ccc(Cl)cc2Cl)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C32H33Cl4NO3/c1-6-37-23-12-31(2,3)14-25(38)28(23)27(29-24(37)13-32(4,5)15-26(29)39)20-9-19(34)11-22(36)30(20)40-16-17-7-8-18(33)10-21(17)35/h7-11,27H,6,12-16H2,1-5H3 |
| InChIKey | QFONXTUPKIEWLM-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.43 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |