C32H35NO5 — CID 126270396
N-(2-methylphenyl)-2-[2-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide (PubChem CID 126270396) has the molecular formula C32H35NO5 and a molecular weight of 513.63 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-[2-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide.
| Compound Name | N-(2-methylphenyl)-2-[2-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126270396 |
| Molecular Formula | C32H35NO5 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | N-(2-methylphenyl)-2-[2-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1ccccc1C1C2=C(CC(C)(C)CC2=O)OC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C32H35NO5/c1-19-10-6-8-12-21(19)33-27(36)18-37-24-13-9-7-11-20(24)28-29-22(34)14-31(2,3)16-25(29)38-26-17-32(4,5)15-23(35)30(26)28/h6-13,28H,14-18H2,1-5H3,(H,33,36) |
| InChIKey | NWKQOJWIIGOKJN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |