C30H29BrO5 — CID 124541062
[4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] 2-bromobenzoate (PubChem CID 124541062) has the molecular formula C30H29BrO5 and a molecular weight of 549.46 g/mol. Its IUPAC name is [4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] 2-bromobenzoate.
| Compound Name | [4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 124541062 |
| Molecular Formula | C30H29BrO5 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | [4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenyl] 2-bromobenzoate |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)CC(C)(C)C1)C2c1ccc(OC(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C30H29BrO5/c1-29(2)13-21(32)26-23(15-29)36-24-16-30(3,4)14-22(33)27(24)25(26)17-9-11-18(12-10-17)35-28(34)19-7-5-6-8-20(19)31/h5-12,25H,13-16H2,1-4H3 |
| InChIKey | WPZLAJRRJWIAFR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|