C25H28BrNO5 — CID 126228377
2-[2-bromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide (PubChem CID 126228377) has the molecular formula C25H28BrNO5 and a molecular weight of 502.41 g/mol. Its IUPAC name is 2-[2-bromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide.
| Compound Name | 2-[2-bromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 126228377 |
| Molecular Formula | C25H28BrNO5 |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 2-[2-bromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)CC(C)(C)C1)C2c1ccc(OCC(N)=O)c(Br)c1 |
| InChI | InChI=1S/C25H28BrNO5/c1-24(2)8-15(28)22-18(10-24)32-19-11-25(3,4)9-16(29)23(19)21(22)13-5-6-17(14(26)7-13)31-12-20(27)30/h5-7,21H,8-12H2,1-4H3,(H2,27,30) |
| InChIKey | CEKHCQDTTFFOEL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |