C26H29BrO7 — CID 1142683
2-[5-bromo-2-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetic acid (PubChem CID 1142683) has the molecular formula C26H29BrO7 and a molecular weight of 533.42 g/mol. Its IUPAC name is 2-[5-bromo-2-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetic acid.
| Compound Name | 2-[5-bromo-2-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 1142683 |
| Molecular Formula | C26H29BrO7 |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 2-[5-bromo-2-methoxy-4-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)phenoxy]acetic acid |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)c(Br)cc1OCC(=O)O |
| InChI | InChI=1S/C26H29BrO7/c1-25(2)8-15(28)23-19(10-25)34-20-11-26(3,4)9-16(29)24(20)22(23)13-6-17(32-5)18(7-14(13)27)33-12-21(30)31/h6-7,22H,8-12H2,1-5H3,(H,30,31) |
| InChIKey | MXGNOAIBOZPUQX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |