C27H32Br2O4 — CID 126054538
9-[3,5-dibromo-4-(2-methylpropoxy)phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 126054538) has the molecular formula C27H32Br2O4 and a molecular weight of 580.36 g/mol. Its IUPAC name is 9-[3,5-dibromo-4-(2-methylpropoxy)phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[3,5-dibromo-4-(2-methylpropoxy)phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 126054538 |
| Molecular Formula | C27H32Br2O4 |
| Molecular Weight | 580.36 g/mol |
| Exact Mass | 578.07 |
| IUPAC Name | 9-[3,5-dibromo-4-(2-methylpropoxy)phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | CC(C)COc1c(Br)cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)cc1Br |
| InChI | InChI=1S/C27H32Br2O4/c1-14(2)13-32-25-16(28)7-15(8-17(25)29)22-23-18(30)9-26(3,4)11-20(23)33-21-12-27(5,6)10-19(31)24(21)22/h7-8,14,22H,9-13H2,1-6H3 |
| InChIKey | RRYHRCXTRJYCSH-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.36 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |