C20H16Cl3N3O2 — CID 4277177
4-[3-chloro-2-(2,6-dichlorophenyl)-4-oxoazetidin-1-yl]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 4277177) has the molecular formula C20H16Cl3N3O2 and a molecular weight of 436.73 g/mol. Its IUPAC name is 4-[3-chloro-2-(2,6-dichlorophenyl)-4-oxoazetidin-1-yl]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[3-chloro-2-(2,6-dichlorophenyl)-4-oxoazetidin-1-yl]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 4277177 |
| Molecular Formula | C20H16Cl3N3O2 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 4-[3-chloro-2-(2,6-dichlorophenyl)-4-oxoazetidin-1-yl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(N2C(=O)C(Cl)C2c2c(Cl)cccc2Cl)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C20H16Cl3N3O2/c1-11-17(20(28)26(24(11)2)12-7-4-3-5-8-12)25-18(16(23)19(25)27)15-13(21)9-6-10-14(15)22/h3-10,16,18H,1-2H3 |
| InChIKey | IRSWIXNYVBWXMP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|