C21H15ClFN3O2S2 — CID 23769978
6-(2-chloro-6-fluorophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazin-4-one (PubChem CID 23769978) has the molecular formula C21H15ClFN3O2S2 and a molecular weight of 459.96 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazin-4-one.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazin-4-one |
|---|---|
| PubChem CID | 23769978 |
| Molecular Formula | C21H15ClFN3O2S2 |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazin-4-one |
| SMILES | Cc1c(-n2c(=O)cc(-c3c(F)cccc3Cl)sc2=S)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H15ClFN3O2S2/c1-12-19(20(28)26(24(12)2)13-7-4-3-5-8-13)25-17(27)11-16(30-21(25)29)18-14(22)9-6-10-15(18)23/h3-11H,1-2H3 |
| InChIKey | YRIXOBXANKAOJS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ester_C(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|