C25H18ClN3O3S2 — CID 23905354
6-[5-(4-chlorophenyl)furan-2-yl]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazin-4-one (PubChem CID 23905354) has the molecular formula C25H18ClN3O3S2 and a molecular weight of 508.02 g/mol. Its IUPAC name is 6-[5-(4-chlorophenyl)furan-2-yl]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazin-4-one.
| Compound Name | 6-[5-(4-chlorophenyl)furan-2-yl]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazin-4-one |
|---|---|
| PubChem CID | 23905354 |
| Molecular Formula | C25H18ClN3O3S2 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | 6-[5-(4-chlorophenyl)furan-2-yl]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazin-4-one |
| SMILES | Cc1c(-n2c(=O)cc(-c3ccc(-c4ccc(Cl)cc4)o3)sc2=S)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C25H18ClN3O3S2/c1-15-23(24(31)29(27(15)2)18-6-4-3-5-7-18)28-22(30)14-21(34-25(28)33)20-13-12-19(32-20)16-8-10-17(26)11-9-16/h3-14H,1-2H3 |
| InChIKey | PPRNTHXTDLKDDK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 62.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ester_C(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|