C27H23ClN4OS — CID 34909125
4-[[3-(4-chlorophenyl)-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 34909125) has the molecular formula C27H23ClN4OS and a molecular weight of 487.03 g/mol. Its IUPAC name is 4-[[3-(4-chlorophenyl)-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-(4-chlorophenyl)-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 34909125 |
| Molecular Formula | C27H23ClN4OS |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 4-[[3-(4-chlorophenyl)-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1ccc(-c2cs/c(=N\c3c(C)n(C)n(-c4ccccc4)c3=O)n2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H23ClN4OS/c1-18-9-11-20(12-10-18)24-17-34-27(31(24)22-15-13-21(28)14-16-22)29-25-19(2)30(3)32(26(25)33)23-7-5-4-6-8-23/h4-17H,1-3H3/b29-27- |
| InChIKey | RIPSVRXSGNFIAB-OHYPFYFLSA-N |
| XLogP | 6.20 |
| TPSA | 44.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|