C25H26Cl2N4OS — CID 23827811
4-[[4-(2,5-dichlorophenyl)-3-pentan-3-yl-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 23827811) has the molecular formula C25H26Cl2N4OS and a molecular weight of 501.48 g/mol. Its IUPAC name is 4-[[4-(2,5-dichlorophenyl)-3-pentan-3-yl-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[4-(2,5-dichlorophenyl)-3-pentan-3-yl-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23827811 |
| Molecular Formula | C25H26Cl2N4OS |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 4-[[4-(2,5-dichlorophenyl)-3-pentan-3-yl-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CCC(CC)n1c(-c2cc(Cl)ccc2Cl)cs/c1=N\c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C25H26Cl2N4OS/c1-5-18(6-2)30-22(20-14-17(26)12-13-21(20)27)15-33-25(30)28-23-16(3)29(4)31(24(23)32)19-10-8-7-9-11-19/h7-15,18H,5-6H2,1-4H3/b28-25- |
| InChIKey | PUMBERWTLPBJOD-FVDSYPCUSA-N |
| XLogP | 6.91 |
| TPSA | 44.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|