C21H20N4OS — CID 1498144
1,5-dimethyl-4-[(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-2-phenylpyrazol-3-one (PubChem CID 1498144) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is 1,5-dimethyl-4-[(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-2-phenylpyrazol-3-one.
| Compound Name | 1,5-dimethyl-4-[(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 1498144 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1,5-dimethyl-4-[(3-methyl-4-phenyl-1,3-thiazol-2-ylidene)amino]-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=c2\scc(-c3ccccc3)n2C)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H20N4OS/c1-15-19(20(26)25(24(15)3)17-12-8-5-9-13-17)22-21-23(2)18(14-27-21)16-10-6-4-7-11-16/h4-14H,1-3H3/b22-21- |
| InChIKey | UYJAZJKOGIYDNI-DQRAZIAOSA-N |
| XLogP | 3.78 |
| TPSA | 44.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|