C29H23BrN6O2S — CID 23818996
3-[[4-(4-bromophenyl)-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,3-thiazol-3-yl]imino]-1-methylindol-2-one (PubChem CID 23818996) has the molecular formula C29H23BrN6O2S and a molecular weight of 599.51 g/mol. Its IUPAC name is 3-[[4-(4-bromophenyl)-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,3-thiazol-3-yl]imino]-1-methylindol-2-one.
| Compound Name | 3-[[4-(4-bromophenyl)-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,3-thiazol-3-yl]imino]-1-methylindol-2-one |
|---|---|
| PubChem CID | 23818996 |
| Molecular Formula | C29H23BrN6O2S |
| Molecular Weight | 599.51 g/mol |
| Exact Mass | 598.08 |
| IUPAC Name | 3-[[4-(4-bromophenyl)-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,3-thiazol-3-yl]imino]-1-methylindol-2-one |
| SMILES | Cc1c(/N=c2\scc(-c3ccc(Br)cc3)n2N=C2C(=O)N(C)c3ccccc32)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C29H23BrN6O2S/c1-18-25(28(38)36(34(18)3)21-9-5-4-6-10-21)31-29-35(24(17-39-29)19-13-15-20(30)16-14-19)32-26-22-11-7-8-12-23(22)33(2)27(26)37/h4-17H,1-3H3/b31-29-,32-26? |
| InChIKey | IAHVCMSRRRCDGR-YKOIWPBWSA-N |
| XLogP | 5.24 |
| TPSA | 76.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|