C30H25BrN6O2S — CID 23850386
3-[[4-(2-bromophenyl)-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,3-thiazol-3-yl]imino]-1-ethylindol-2-one (PubChem CID 23850386) has the molecular formula C30H25BrN6O2S and a molecular weight of 613.54 g/mol. Its IUPAC name is 3-[[4-(2-bromophenyl)-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,3-thiazol-3-yl]imino]-1-ethylindol-2-one.
| Compound Name | 3-[[4-(2-bromophenyl)-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,3-thiazol-3-yl]imino]-1-ethylindol-2-one |
|---|---|
| PubChem CID | 23850386 |
| Molecular Formula | C30H25BrN6O2S |
| Molecular Weight | 613.54 g/mol |
| Exact Mass | 612.09 |
| IUPAC Name | 3-[[4-(2-bromophenyl)-2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-1,3-thiazol-3-yl]imino]-1-ethylindol-2-one |
| SMILES | CCN1C(=O)C(=Nn2c(-c3ccccc3Br)cs/c2=N\c2c(C)n(C)n(-c3ccccc3)c2=O)c2ccccc21 |
| InChI | InChI=1S/C30H25BrN6O2S/c1-4-35-24-17-11-9-15-22(24)27(28(35)38)33-36-25(21-14-8-10-16-23(21)31)18-40-30(36)32-26-19(2)34(3)37(29(26)39)20-12-6-5-7-13-20/h5-18H,4H2,1-3H3/b32-30-,33-27? |
| InChIKey | ZVLINIYHNVCRFH-ODKXTABYSA-N |
| XLogP | 5.63 |
| TPSA | 76.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|