C28H29N5OS — CID 23738484
4-[[3-(cyclohex-3-en-1-ylmethylideneamino)-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 23738484) has the molecular formula C28H29N5OS and a molecular weight of 483.64 g/mol. Its IUPAC name is 4-[[3-(cyclohex-3-en-1-ylmethylideneamino)-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-(cyclohex-3-en-1-ylmethylideneamino)-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23738484 |
| Molecular Formula | C28H29N5OS |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 4-[[3-(cyclohex-3-en-1-ylmethylideneamino)-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1ccc(-c2cs/c(=N\c3c(C)n(C)n(-c4ccccc4)c3=O)n2N=CC2CC=CCC2)cc1 |
| InChI | InChI=1S/C28H29N5OS/c1-20-14-16-23(17-15-20)25-19-35-28(32(25)29-18-22-10-6-4-7-11-22)30-26-21(2)31(3)33(27(26)34)24-12-8-5-9-13-24/h4-6,8-9,12-19,22H,7,10-11H2,1-3H3/b29-18?,30-28- |
| InChIKey | QTHFUOUJVOJMQL-DNAPFHOSSA-N |
| XLogP | 5.75 |
| TPSA | 56.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|