C27H26FN5OS — CID 23825985
4-[[3-(cyclohex-3-en-1-ylmethylideneamino)-4-(2-fluorophenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 23825985) has the molecular formula C27H26FN5OS and a molecular weight of 487.60 g/mol. Its IUPAC name is 4-[[3-(cyclohex-3-en-1-ylmethylideneamino)-4-(2-fluorophenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-(cyclohex-3-en-1-ylmethylideneamino)-4-(2-fluorophenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23825985 |
| Molecular Formula | C27H26FN5OS |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 4-[[3-(cyclohex-3-en-1-ylmethylideneamino)-4-(2-fluorophenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=c2\scc(-c3ccccc3F)n2N=CC2CC=CCC2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C27H26FN5OS/c1-19-25(26(34)33(31(19)2)21-13-7-4-8-14-21)30-27-32(29-17-20-11-5-3-6-12-20)24(18-35-27)22-15-9-10-16-23(22)28/h3-5,7-10,13-18,20H,6,11-12H2,1-2H3/b29-17?,30-27- |
| InChIKey | IRTZGSFRPDOXBK-JZGJLBPRSA-N |
| XLogP | 5.58 |
| TPSA | 56.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|