C26H26Cl2N4OS — CID 23851876
4-[[3-cyclohexyl-4-(2,4-dichlorophenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 23851876) has the molecular formula C26H26Cl2N4OS and a molecular weight of 513.49 g/mol. Its IUPAC name is 4-[[3-cyclohexyl-4-(2,4-dichlorophenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-cyclohexyl-4-(2,4-dichlorophenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23851876 |
| Molecular Formula | C26H26Cl2N4OS |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 4-[[3-cyclohexyl-4-(2,4-dichlorophenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=c2\scc(-c3ccc(Cl)cc3Cl)n2C2CCCCC2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C26H26Cl2N4OS/c1-17-24(25(33)32(30(17)2)20-11-7-4-8-12-20)29-26-31(19-9-5-3-6-10-19)23(16-34-26)21-14-13-18(27)15-22(21)28/h4,7-8,11-16,19H,3,5-6,9-10H2,1-2H3/b29-26- |
| InChIKey | YBRUTFKJGKPOJE-WCTVFOPTSA-N |
| XLogP | 7.06 |
| TPSA | 44.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|