C27H29ClN4OS — CID 23912471
4-[[4-(3-chlorophenyl)-3-(2-methylcyclohexyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 23912471) has the molecular formula C27H29ClN4OS and a molecular weight of 493.08 g/mol. Its IUPAC name is 4-[[4-(3-chlorophenyl)-3-(2-methylcyclohexyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[4-(3-chlorophenyl)-3-(2-methylcyclohexyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23912471 |
| Molecular Formula | C27H29ClN4OS |
| Molecular Weight | 493.08 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 4-[[4-(3-chlorophenyl)-3-(2-methylcyclohexyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=c2\scc(-c3cccc(Cl)c3)n2C2CCCCC2C)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C27H29ClN4OS/c1-18-10-7-8-15-23(18)31-24(20-11-9-12-21(28)16-20)17-34-27(31)29-25-19(2)30(3)32(26(25)33)22-13-5-4-6-14-22/h4-6,9,11-14,16-18,23H,7-8,10,15H2,1-3H3/b29-27- |
| InChIKey | UIOBYCONBVDJNZ-OHYPFYFLSA-N |
| XLogP | 6.65 |
| TPSA | 44.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.08 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|