C29H30N4O2S — CID 23909535
4-[[4-(1-benzofuran-2-yl)-3-(2-methylcyclohexyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 23909535) has the molecular formula C29H30N4O2S and a molecular weight of 498.65 g/mol. Its IUPAC name is 4-[[4-(1-benzofuran-2-yl)-3-(2-methylcyclohexyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[4-(1-benzofuran-2-yl)-3-(2-methylcyclohexyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23909535 |
| Molecular Formula | C29H30N4O2S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 4-[[4-(1-benzofuran-2-yl)-3-(2-methylcyclohexyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=c2\scc(-c3cc4ccccc4o3)n2C2CCCCC2C)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C29H30N4O2S/c1-19-11-7-9-15-23(19)32-24(26-17-21-12-8-10-16-25(21)35-26)18-36-29(32)30-27-20(2)31(3)33(28(27)34)22-13-5-4-6-14-22/h4-6,8,10,12-14,16-19,23H,7,9,11,15H2,1-3H3/b30-29- |
| InChIKey | VPIOPAJAGWBQSZ-FLWNBWAVSA-N |
| XLogP | 6.74 |
| TPSA | 57.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|