C29H22N6O4S — CID 23995204
4-[[4-(1-benzofuran-2-yl)-3-[(2-nitrophenyl)methylideneamino]-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 23995204) has the molecular formula C29H22N6O4S and a molecular weight of 550.60 g/mol. Its IUPAC name is 4-[[4-(1-benzofuran-2-yl)-3-[(2-nitrophenyl)methylideneamino]-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[4-(1-benzofuran-2-yl)-3-[(2-nitrophenyl)methylideneamino]-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23995204 |
| Molecular Formula | C29H22N6O4S |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 4-[[4-(1-benzofuran-2-yl)-3-[(2-nitrophenyl)methylideneamino]-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=c2\scc(-c3cc4ccccc4o3)n2N=Cc2ccccc2[N+](=O)[O-])c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C29H22N6O4S/c1-19-27(28(36)34(32(19)2)22-12-4-3-5-13-22)31-29-33(30-17-21-11-6-8-14-23(21)35(37)38)24(18-40-29)26-16-20-10-7-9-15-25(20)39-26/h3-18H,1-2H3/b30-17?,31-29- |
| InChIKey | MZEAXKXVLNMCNQ-YOQBWWMFSA-N |
| XLogP | 5.78 |
| TPSA | 112.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|