C22H19N5O2S — CID 135512311
4-[[5-(1-benzofuran-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 135512311) has the molecular formula C22H19N5O2S and a molecular weight of 417.49 g/mol. Its IUPAC name is 4-[[5-(1-benzofuran-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[5-(1-benzofuran-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 135512311 |
| Molecular Formula | C22H19N5O2S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 4-[[5-(1-benzofuran-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=C2/NN=C(c3cc4ccccc4o3)CS2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C22H19N5O2S/c1-14-20(21(28)27(26(14)2)16-9-4-3-5-10-16)23-22-25-24-17(13-30-22)19-12-15-8-6-7-11-18(15)29-19/h3-12H,13H2,1-2H3,(H,23,25) |
| InChIKey | NMCMPYBBTUMUBC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|