C33H29N5O2S — CID 135676741
4-[[3-[1-(1-hydroxynaphthalen-2-yl)ethylideneamino]-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 135676741) has the molecular formula C33H29N5O2S and a molecular weight of 559.70 g/mol. Its IUPAC name is 4-[[3-[1-(1-hydroxynaphthalen-2-yl)ethylideneamino]-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-[1-(1-hydroxynaphthalen-2-yl)ethylideneamino]-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 135676741 |
| Molecular Formula | C33H29N5O2S |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 4-[[3-[1-(1-hydroxynaphthalen-2-yl)ethylideneamino]-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CC(=Nn1c(-c2ccc(C)cc2)cs/c1=N\c1c(C)n(C)n(-c2ccccc2)c1=O)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C33H29N5O2S/c1-21-14-16-25(17-15-21)29-20-41-33(34-30-23(3)36(4)38(32(30)40)26-11-6-5-7-12-26)37(29)35-22(2)27-19-18-24-10-8-9-13-28(24)31(27)39/h5-20,39H,1-4H3/b34-33-,35-22? |
| InChIKey | CKMVZKKVBLRTRW-UJLVCQJMSA-N |
| XLogP | 6.69 |
| TPSA | 76.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|