C31H28N6O5S — CID 135625663
6-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-[1-(2-hydroxy-4-methoxyphenyl)ethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 135625663) has the molecular formula C31H28N6O5S and a molecular weight of 596.67 g/mol. Its IUPAC name is 6-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-[1-(2-hydroxy-4-methoxyphenyl)ethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-[1-(2-hydroxy-4-methoxyphenyl)ethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 135625663 |
| Molecular Formula | C31H28N6O5S |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | 6-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-[1-(2-hydroxy-4-methoxyphenyl)ethylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccc(C(C)=Nn2c(-c3ccc4c(c3)NC(=O)CO4)cs/c2=N\c2c(C)n(C)n(-c3ccccc3)c2=O)c(O)c1 |
| InChI | InChI=1S/C31H28N6O5S/c1-18(23-12-11-22(41-4)15-26(23)38)34-36-25(20-10-13-27-24(14-20)32-28(39)16-42-27)17-43-31(36)33-29-19(2)35(3)37(30(29)40)21-8-6-5-7-9-21/h5-15,17,38H,16H2,1-4H3,(H,32,39)/b33-31-,34-18? |
| InChIKey | LDUXIDCLROPTNG-KWSCUKGASA-N |
| XLogP | 4.56 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|