C32H31N5O3S — CID 23793584
6-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-(4-phenylbutan-2-yl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23793584) has the molecular formula C32H31N5O3S and a molecular weight of 565.70 g/mol. Its IUPAC name is 6-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-(4-phenylbutan-2-yl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-(4-phenylbutan-2-yl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23793584 |
| Molecular Formula | C32H31N5O3S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | 6-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-3-(4-phenylbutan-2-yl)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1c(/N=c2\scc(-c3ccc4c(c3)NC(=O)CO4)n2C(C)CCc2ccccc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C32H31N5O3S/c1-21(14-15-23-10-6-4-7-11-23)36-27(24-16-17-28-26(18-24)33-29(38)19-40-28)20-41-32(36)34-30-22(2)35(3)37(31(30)39)25-12-8-5-9-13-25/h4-13,16-18,20-21H,14-15,19H2,1-3H3,(H,33,38)/b34-32- |
| InChIKey | HZZAPWNRLBHYJS-YJKCNMNRSA-N |
| XLogP | 5.77 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|