C23H26N4OS2 — CID 23967747
1,5-dimethyl-4-[(3-pentan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-ylidene)amino]-2-phenylpyrazol-3-one (PubChem CID 23967747) has the molecular formula C23H26N4OS2 and a molecular weight of 438.62 g/mol. Its IUPAC name is 1,5-dimethyl-4-[(3-pentan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-ylidene)amino]-2-phenylpyrazol-3-one.
| Compound Name | 1,5-dimethyl-4-[(3-pentan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-ylidene)amino]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23967747 |
| Molecular Formula | C23H26N4OS2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 1,5-dimethyl-4-[(3-pentan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-ylidene)amino]-2-phenylpyrazol-3-one |
| SMILES | CCCC(C)n1c(-c2cccs2)cs/c1=N\c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C23H26N4OS2/c1-5-10-16(2)26-19(20-13-9-14-29-20)15-30-23(26)24-21-17(3)25(4)27(22(21)28)18-11-7-6-8-12-18/h6-9,11-16H,5,10H2,1-4H3/b24-23- |
| InChIKey | VGKMXJOMPYBMIT-VHXPQNKSSA-N |
| XLogP | 5.67 |
| TPSA | 44.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|