C21H22N4O2S — CID 23905787
6-(3-pentan-2-yl-2-pyridin-3-ylimino-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 23905787) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is 6-(3-pentan-2-yl-2-pyridin-3-ylimino-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(3-pentan-2-yl-2-pyridin-3-ylimino-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23905787 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 6-(3-pentan-2-yl-2-pyridin-3-ylimino-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | CCCC(C)n1c(-c2ccc3c(c2)NC(=O)CO3)cs/c1=N\c1cccnc1 |
| InChI | InChI=1S/C21H22N4O2S/c1-3-5-14(2)25-18(13-28-21(25)23-16-6-4-9-22-11-16)15-7-8-19-17(10-15)24-20(26)12-27-19/h4,6-11,13-14H,3,5,12H2,1-2H3,(H,24,26)/b23-21- |
| InChIKey | UYOUXMQDKDTVFL-LNVKXUELSA-N |
| XLogP | 4.54 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|