C27H26N6O3S — CID 135769175
6-[3-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-pyridin-3-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 135769175) has the molecular formula C27H26N6O3S and a molecular weight of 514.61 g/mol. Its IUPAC name is 6-[3-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-pyridin-3-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-pyridin-3-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 135769175 |
| Molecular Formula | C27H26N6O3S |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 6-[3-[[4-(diethylamino)-2-hydroxyphenyl]methylideneamino]-2-pyridin-3-ylimino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CCN(CC)c1ccc(C=Nn2c(-c3ccc4c(c3)NC(=O)CO4)cs/c2=N\c2cccnc2)c(O)c1 |
| InChI | InChI=1S/C27H26N6O3S/c1-3-32(4-2)21-9-7-19(24(34)13-21)14-29-33-23(17-37-27(33)30-20-6-5-11-28-15-20)18-8-10-25-22(12-18)31-26(35)16-36-25/h5-15,17,34H,3-4,16H2,1-2H3,(H,31,35)/b29-14?,30-27- |
| InChIKey | YDUFDUGRDOVNDO-FKLCEYQGSA-N |
| XLogP | 4.61 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|