C27H29N5OS — CID 135838942
5-(diethylamino)-2-[[4-(3,4-dimethylphenyl)-2-pyridin-3-ylimino-1,3-thiazol-3-yl]iminomethyl]phenol (PubChem CID 135838942) has the molecular formula C27H29N5OS and a molecular weight of 471.63 g/mol. Its IUPAC name is 5-(diethylamino)-2-[[4-(3,4-dimethylphenyl)-2-pyridin-3-ylimino-1,3-thiazol-3-yl]iminomethyl]phenol.
| Compound Name | 5-(diethylamino)-2-[[4-(3,4-dimethylphenyl)-2-pyridin-3-ylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135838942 |
| Molecular Formula | C27H29N5OS |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 5-(diethylamino)-2-[[4-(3,4-dimethylphenyl)-2-pyridin-3-ylimino-1,3-thiazol-3-yl]iminomethyl]phenol |
| SMILES | CCN(CC)c1ccc(C=Nn2c(-c3ccc(C)c(C)c3)cs/c2=N\c2cccnc2)c(O)c1 |
| InChI | InChI=1S/C27H29N5OS/c1-5-31(6-2)24-12-11-22(26(33)15-24)16-29-32-25(21-10-9-19(3)20(4)14-21)18-34-27(32)30-23-8-7-13-28-17-23/h7-18,33H,5-6H2,1-4H3/b29-16?,30-27- |
| InChIKey | ZRJSJEVYKKBFRT-GTUFNBTISA-N |
| XLogP | 5.89 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|