C26H23N5O5S — CID 23737401
6-[2-pyridin-3-ylimino-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23737401) has the molecular formula C26H23N5O5S and a molecular weight of 517.57 g/mol. Its IUPAC name is 6-[2-pyridin-3-ylimino-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-pyridin-3-ylimino-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23737401 |
| Molecular Formula | C26H23N5O5S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 6-[2-pyridin-3-ylimino-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1cc(OC)c(OC)cc1C=Nn1c(-c2ccc3c(c2)NC(=O)CO3)cs/c1=N\c1cccnc1 |
| InChI | InChI=1S/C26H23N5O5S/c1-33-22-11-24(35-3)23(34-2)10-17(22)12-28-31-20(15-37-26(31)29-18-5-4-8-27-13-18)16-6-7-21-19(9-16)30-25(32)14-36-21/h4-13,15H,14H2,1-3H3,(H,30,32)/b28-12?,29-26- |
| InChIKey | DUDRCYFHPOWGCM-SAFBFHGDSA-N |
| XLogP | 4.08 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|