C25H21N5O2S — CID 23768885
6-[2-(3-methylphenyl)imino-3-(1-pyridin-3-ylethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23768885) has the molecular formula C25H21N5O2S and a molecular weight of 455.54 g/mol. Its IUPAC name is 6-[2-(3-methylphenyl)imino-3-(1-pyridin-3-ylethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(3-methylphenyl)imino-3-(1-pyridin-3-ylethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23768885 |
| Molecular Formula | C25H21N5O2S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 6-[2-(3-methylphenyl)imino-3-(1-pyridin-3-ylethylideneamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(=Nn1c(-c2ccc3c(c2)NC(=O)CO3)cs/c1=N\c1cccc(C)c1)c1cccnc1 |
| InChI | InChI=1S/C25H21N5O2S/c1-16-5-3-7-20(11-16)27-25-30(29-17(2)19-6-4-10-26-13-19)22(15-33-25)18-8-9-23-21(12-18)28-24(31)14-32-23/h3-13,15H,14H2,1-2H3,(H,28,31)/b27-25-,29-17? |
| InChIKey | IIZLKVWLXQFWNE-AYCGGLHLSA-N |
| XLogP | 4.76 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|